C22H15FN6O2 — CID 86030537
5-fluoro-2-N,4-N-bis[3-(1,3-oxazol-2-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 86030537) has the molecular formula C22H15FN6O2 and a molecular weight of 414.40 g/mol. Its IUPAC name is 5-fluoro-2-N,4-N-bis[3-(1,3-oxazol-2-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N,4-N-bis[3-(1,3-oxazol-2-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 86030537 |
| Molecular Formula | C22H15FN6O2 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 5-fluoro-2-N,4-N-bis[3-(1,3-oxazol-2-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Fc1cnc(Nc2cccc(-c3ncco3)c2)nc1Nc1cccc(-c2ncco2)c1 |
| InChI | InChI=1S/C22H15FN6O2/c23-18-13-26-22(28-17-6-2-4-15(12-17)21-25-8-10-31-21)29-19(18)27-16-5-1-3-14(11-16)20-24-7-9-30-20/h1-13H,(H2,26,27,28,29) |
| InChIKey | MSCURAOFASUUIH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |