C20H30N+ — CID 101206039
diethyl-[(2Z,4Z,7Z)-9-(4-methylphenyl)nona-2,4,7-trienyl]azanium (PubChem CID 101206039) has the molecular formula C20H30N+ and a molecular weight of 284.47 g/mol. Its IUPAC name is diethyl-[(2Z,4Z,7Z)-9-(4-methylphenyl)nona-2,4,7-trienyl]azanium.
| Compound Name | diethyl-[(2Z,4Z,7Z)-9-(4-methylphenyl)nona-2,4,7-trienyl]azanium |
|---|---|
| PubChem CID | 101206039 |
| Molecular Formula | C20H30N+ |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | diethyl-[(2Z,4Z,7Z)-9-(4-methylphenyl)nona-2,4,7-trienyl]azanium |
| SMILES | CC[NH+](CC)C/C=C\C=C/C/C=C\Cc1ccc(C)cc1 |
| InChI | InChI=1S/C20H29N/c1-4-21(5-2)18-12-10-8-6-7-9-11-13-20-16-14-19(3)15-17-20/h6,8-12,14-17H,4-5,7,13,18H2,1-3H3/p+1/b8-6-,11-9-,12-10- |
| InChIKey | LNYKIJHNIWDRBF-GCOHQANWSA-O |
| XLogP | 3.52 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|