C15H24O2 — CID 101206587
(3aR,9S,9aS)-9-methoxy-7-prop-2-enyl-1,2,3,3a,4,5,7,8,9,9a-decahydrocyclopenta[8]annulen-6-one (PubChem CID 101206587) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aR,9S,9aS)-9-methoxy-7-prop-2-enyl-1,2,3,3a,4,5,7,8,9,9a-decahydrocyclopenta[8]annulen-6-one.
| Compound Name | (3aR,9S,9aS)-9-methoxy-7-prop-2-enyl-1,2,3,3a,4,5,7,8,9,9a-decahydrocyclopenta[8]annulen-6-one |
|---|---|
| PubChem CID | 101206587 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aR,9S,9aS)-9-methoxy-7-prop-2-enyl-1,2,3,3a,4,5,7,8,9,9a-decahydrocyclopenta[8]annulen-6-one |
| SMILES | C=CCC1C[C@H](OC)[C@H]2CCC[C@@H]2CCC1=O |
| InChI | InChI=1S/C15H24O2/c1-3-5-12-10-15(17-2)13-7-4-6-11(13)8-9-14(12)16/h3,11-13,15H,1,4-10H2,2H3/t11-,12?,13+,15+/m1/s1 |
| InChIKey | RYXBDILSWRJDDS-YKURLNKLSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|