C24H44O2 — CID 57311203
4-ethenyl-2-methoxy-8-[(1S,2S)-2-octylcyclopentyl]octan-3-one (PubChem CID 57311203) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is 4-ethenyl-2-methoxy-8-[(1S,2S)-2-octylcyclopentyl]octan-3-one.
| Compound Name | 4-ethenyl-2-methoxy-8-[(1S,2S)-2-octylcyclopentyl]octan-3-one |
|---|---|
| PubChem CID | 57311203 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 4-ethenyl-2-methoxy-8-[(1S,2S)-2-octylcyclopentyl]octan-3-one |
| SMILES | C=CC(CCCC[C@H]1CCC[C@@H]1CCCCCCCC)C(=O)C(C)OC |
| InChI | InChI=1S/C24H44O2/c1-5-7-8-9-10-11-16-22-18-14-19-23(22)17-13-12-15-21(6-2)24(25)20(3)26-4/h6,20-23H,2,5,7-19H2,1,3-4H3/t20?,21?,22-,23-/m0/s1 |
| InChIKey | SBZATPRPNWUYGM-BBITVKMKSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|