About [(E)-prop-1-enoxy]benzene;zinc;chloride
[(E)-prop-1-enoxy]benzene;zinc;chloride (PubChem CID 101206990) has the molecular formula C9H10ClOZn-
and a molecular weight of 235.02 g/mol. Its IUPAC name is [(E)-prop-1-enoxy]benzene;zinc;chloride.
Molecular Properties
| Compound Name | [(E)-prop-1-enoxy]benzene;zinc;chloride |
| PubChem CID | 101206990 |
| Molecular Formula | C9H10ClOZn- |
| Molecular Weight | 235.02 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | [(E)-prop-1-enoxy]benzene;zinc;chloride |
| SMILES | C/C=C/Oc1ccccc1.[Cl-].[Zn] |
| InChI | InChI=1S/C9H10O.ClH.Zn/c1-2-8-10-9-6-4-3-5-7-9;;/h2-8H,1H3;1H;/p-1/b8-2+;; |
| InChIKey | OMJWSOJJZUGXOY-SZPWSVBHSA-M |
| XLogP | -0.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.02 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-prop-1-enoxy]benzene;zinc;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-prop-1-enoxy]benzene;zinc;chloride?
The IUPAC name of [(E)-prop-1-enoxy]benzene;zinc;chloride (CID 101206990) is [(E)-prop-1-enoxy]benzene;zinc;chloride.
What is the SMILES notation for [(E)-prop-1-enoxy]benzene;zinc;chloride?
The canonical SMILES for [(E)-prop-1-enoxy]benzene;zinc;chloride is C/C=C/Oc1ccccc1.[Cl-].[Zn].
What is the InChIKey of [(E)-prop-1-enoxy]benzene;zinc;chloride?
The InChIKey is OMJWSOJJZUGXOY-SZPWSVBHSA-M. The full InChI is InChI=1S/C9H10O.ClH.Zn/c1-2-8-10-9-6-4-3-5-7-9;;/h2-8H,1H3;1H;/p-1/b8-2+;;.
What are the key properties of [(E)-prop-1-enoxy]benzene;zinc;chloride?
[(E)-prop-1-enoxy]benzene;zinc;chloride has a molecular weight of 235.02 g/mol, XLogP of -0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-prop-1-enoxy]benzene;zinc;chloride is sourced from PubChem (CID 101206990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).