About 2-phenoxyethenylbenzene;1,2-xylene
2-phenoxyethenylbenzene;1,2-xylene (PubChem CID 174396691) has the molecular formula C22H22O
and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-phenoxyethenylbenzene;1,2-xylene.
Molecular Properties
| Compound Name | 2-phenoxyethenylbenzene;1,2-xylene |
| PubChem CID | 174396691 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-phenoxyethenylbenzene;1,2-xylene |
| SMILES | C(=Cc1ccccc1)Oc1ccccc1.Cc1ccccc1C |
| InChI | InChI=1S/C14H12O.C8H10/c1-3-7-13(8-4-1)11-12-15-14-9-5-2-6-10-14;1-7-5-3-4-6-8(7)2/h1-12H;3-6H,1-2H3 |
| InChIKey | IRWNGDGZFNKELH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethenylbenzene;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethenylbenzene;1,2-xylene?
The IUPAC name of 2-phenoxyethenylbenzene;1,2-xylene (CID 174396691) is 2-phenoxyethenylbenzene;1,2-xylene.
What is the SMILES notation for 2-phenoxyethenylbenzene;1,2-xylene?
The canonical SMILES for 2-phenoxyethenylbenzene;1,2-xylene is C(=Cc1ccccc1)Oc1ccccc1.Cc1ccccc1C.
What is the InChIKey of 2-phenoxyethenylbenzene;1,2-xylene?
The InChIKey is IRWNGDGZFNKELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.C8H10/c1-3-7-13(8-4-1)11-12-15-14-9-5-2-6-10-14;1-7-5-3-4-6-8(7)2/h1-12H;3-6H,1-2H3.
What are the key properties of 2-phenoxyethenylbenzene;1,2-xylene?
2-phenoxyethenylbenzene;1,2-xylene has a molecular weight of 302.42 g/mol, XLogP of 6.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethenylbenzene;1,2-xylene is sourced from PubChem (CID 174396691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).