C32H40F3N3O3 — CID 10120725
N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-4-(trifluoromethyl)benzamide (PubChem CID 10120725) has the molecular formula C32H40F3N3O3 and a molecular weight of 571.68 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 10120725 |
| Molecular Formula | C32H40F3N3O3 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | N-[(1S,2R)-2-[[(3S)-5-methyl-2-oxo-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)hexan-3-yl]carbamoyl]cyclohexyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1ccc(C(F)(F)F)cc1)C(=O)CN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C32H40F3N3O3/c1-21(2)18-28(29(39)20-38-17-7-10-22-8-3-4-9-24(22)19-38)37-31(41)26-11-5-6-12-27(26)36-30(40)23-13-15-25(16-14-23)32(33,34)35/h3-4,8-9,13-16,21,26-28H,5-7,10-12,17-20H2,1-2H3,(H,36,40)(H,37,41)/t26-,27+,28+/m1/s1 |
| InChIKey | OWYFAWDEVUEDFG-PKTNWEFCSA-N |
| XLogP | 5.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |