C39H51N3O — CID 142078388
N-[(1S,2R)-2-[1-[[(3S)-2-[[5-[(1Z)-buta-1,3-dienyl]-2,3,4,7-tetrahydroazepin-1-yl]methyl]-5-methylhex-1-en-3-yl]amino]ethenyl]cyclohexyl]-4-phenylbenzamide (PubChem CID 142078388) has the molecular formula C39H51N3O and a molecular weight of 577.86 g/mol. Its IUPAC name is N-[(1S,2R)-2-[1-[[(3S)-2-[[5-[(1Z)-buta-1,3-dienyl]-2,3,4,7-tetrahydroazepin-1-yl]methyl]-5-methylhex-1-en-3-yl]amino]ethenyl]cyclohexyl]-4-phenylbenzamide.
| Compound Name | N-[(1S,2R)-2-[1-[[(3S)-2-[[5-[(1Z)-buta-1,3-dienyl]-2,3,4,7-tetrahydroazepin-1-yl]methyl]-5-methylhex-1-en-3-yl]amino]ethenyl]cyclohexyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 142078388 |
| Molecular Formula | C39H51N3O |
| Molecular Weight | 577.86 g/mol |
| Exact Mass | 577.40 |
| IUPAC Name | N-[(1S,2R)-2-[1-[[(3S)-2-[[5-[(1Z)-buta-1,3-dienyl]-2,3,4,7-tetrahydroazepin-1-yl]methyl]-5-methylhex-1-en-3-yl]amino]ethenyl]cyclohexyl]-4-phenylbenzamide |
| SMILES | C=C/C=C\C1=CCN(CC(=C)[C@H](CC(C)C)NC(=C)[C@@H]2CCCC[C@@H]2NC(=O)c2ccc(-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C39H51N3O/c1-6-7-14-32-15-13-25-42(26-24-32)28-30(4)38(27-29(2)3)40-31(5)36-18-11-12-19-37(36)41-39(43)35-22-20-34(21-23-35)33-16-9-8-10-17-33/h6-10,14,16-17,20-24,29,36-38,40H,1,4-5,11-13,15,18-19,25-28H2,2-3H3,(H,41,43)/b14-7-/t36-,37-,38-/m0/s1 |
| InChIKey | JXIJFLUKUZMRMD-YQFYKMIFSA-N |
| XLogP | 8.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.86 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|