C8H11N — CID 101207318
trans-(1R,2S)-2-[(Z)-prop-1-enyl]cyclobutane-1-carbonitrile (PubChem CID 101207318) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is trans-(1R,2S)-2-[(Z)-prop-1-enyl]cyclobutane-1-carbonitrile.
| Compound Name | trans-(1R,2S)-2-[(Z)-prop-1-enyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 101207318 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | trans-(1R,2S)-2-[(Z)-prop-1-enyl]cyclobutane-1-carbonitrile |
| SMILES | C/C=C\[C@@H]1CC[C@H]1C#N |
| InChI | InChI=1S/C8H11N/c1-2-3-7-4-5-8(7)6-9/h2-3,7-8H,4-5H2,1H3/b3-2-/t7-,8+/m1/s1 |
| InChIKey | UMYMWDJCFBBOOA-ZCMHJKFASA-N |
| XLogP | 2.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|