About cyclohexane-1,2,3,4-tetracarbonitrile
cyclohexane-1,2,3,4-tetracarbonitrile (PubChem CID 87163155) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is cyclohexane-1,2,3,4-tetracarbonitrile.
Molecular Properties
| Compound Name | cyclohexane-1,2,3,4-tetracarbonitrile |
| PubChem CID | 87163155 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | cyclohexane-1,2,3,4-tetracarbonitrile |
| SMILES | N#CC1CCC(C#N)C(C#N)C1C#N |
| InChI | InChI=1S/C10H8N4/c11-3-7-1-2-8(4-12)10(6-14)9(7)5-13/h7-10H,1-2H2 |
| InChIKey | MNJVASQSXWUXAI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexane-1,2,3,4-tetracarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,2,3,4-tetracarbonitrile?
The IUPAC name of cyclohexane-1,2,3,4-tetracarbonitrile (CID 87163155) is cyclohexane-1,2,3,4-tetracarbonitrile.
What is the SMILES notation for cyclohexane-1,2,3,4-tetracarbonitrile?
The canonical SMILES for cyclohexane-1,2,3,4-tetracarbonitrile is N#CC1CCC(C#N)C(C#N)C1C#N.
What is the InChIKey of cyclohexane-1,2,3,4-tetracarbonitrile?
The InChIKey is MNJVASQSXWUXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c11-3-7-1-2-8(4-12)10(6-14)9(7)5-13/h7-10H,1-2H2.
What are the key properties of cyclohexane-1,2,3,4-tetracarbonitrile?
cyclohexane-1,2,3,4-tetracarbonitrile has a molecular weight of 184.20 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,2,3,4-tetracarbonitrile is sourced from PubChem (CID 87163155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).