C13H24O2Si — CID 101207969
methyl (2Z)-2-methyl-3-trimethylsilylocta-2,7-dienoate (PubChem CID 101207969) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is methyl (2Z)-2-methyl-3-trimethylsilylocta-2,7-dienoate.
| Compound Name | methyl (2Z)-2-methyl-3-trimethylsilylocta-2,7-dienoate |
|---|---|
| PubChem CID | 101207969 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl (2Z)-2-methyl-3-trimethylsilylocta-2,7-dienoate |
| SMILES | C=CCCC/C(=C(\C)C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C13H24O2Si/c1-7-8-9-10-12(16(4,5)6)11(2)13(14)15-3/h7H,1,8-10H2,2-6H3/b12-11- |
| InChIKey | CYYGVIGYYDTDSH-QXMHVHEDSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|