C23H29NO12 — CID 101208134
[(2S,3S,6S)-6-cyano-3-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101208134) has the molecular formula C23H29NO12 and a molecular weight of 511.48 g/mol. Its IUPAC name is [(2S,3S,6S)-6-cyano-3-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-6-cyano-3-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101208134 |
| Molecular Formula | C23H29NO12 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [(2S,3S,6S)-6-cyano-3-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#N)C=C[C@@H]1[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H29NO12/c1-11(25)30-9-18-17(7-6-16(8-24)35-18)20-22(33-14(4)28)23(34-15(5)29)21(32-13(3)27)19(36-20)10-31-12(2)26/h6-7,16-23H,9-10H2,1-5H3/t16-,17-,18+,19+,20-,21-,22-,23-/m0/s1 |
| InChIKey | DFECEPDBKJRPSY-WNCKLLFJSA-N |
| XLogP | 0.14 |
| TPSA | 173.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|