C24H28N4O4S4 — CID 101208249
6,7,21,22-tetrathia-3,10,18,25-tetrazatricyclo[25.3.1.112,16]dotriaconta-1(31),12(32),13,15,27,29-hexaene-2,11,17,26-tetrone (PubChem CID 101208249) has the molecular formula C24H28N4O4S4 and a molecular weight of 564.78 g/mol. Its IUPAC name is 6,7,21,22-tetrathia-3,10,18,25-tetrazatricyclo[25.3.1.112,16]dotriaconta-1(31),12(32),13,15,27,29-hexaene-2,11,17,26-tetrone.
| Compound Name | 6,7,21,22-tetrathia-3,10,18,25-tetrazatricyclo[25.3.1.112,16]dotriaconta-1(31),12(32),13,15,27,29-hexaene-2,11,17,26-tetrone |
|---|---|
| PubChem CID | 101208249 |
| Molecular Formula | C24H28N4O4S4 |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 6,7,21,22-tetrathia-3,10,18,25-tetrazatricyclo[25.3.1.112,16]dotriaconta-1(31),12(32),13,15,27,29-hexaene-2,11,17,26-tetrone |
| SMILES | O=C1NCCSSCCNC(=O)c2cccc(c2)C(=O)NCCSSCCNC(=O)c2cccc1c2 |
| InChI | InChI=1S/C24H28N4O4S4/c29-21-17-3-1-4-18(15-17)22(30)26-8-12-34-36-14-10-28-24(32)20-6-2-5-19(16-20)23(31)27-9-13-35-33-11-7-25-21/h1-6,15-16H,7-14H2,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | UZBMSSVWYUBNJU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|