C32H30N2O4 — CID 132513783
3,11-dioxa-18,26-diazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-19,25-dione (PubChem CID 132513783) has the molecular formula C32H30N2O4 and a molecular weight of 506.60 g/mol. Its IUPAC name is 3,11-dioxa-18,26-diazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-19,25-dione.
| Compound Name | 3,11-dioxa-18,26-diazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-19,25-dione |
|---|---|
| PubChem CID | 132513783 |
| Molecular Formula | C32H30N2O4 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 3,11-dioxa-18,26-diazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-19,25-dione |
| SMILES | O=C1NCc2ccc(cc2)COCc2cccc(c2)COCc2ccc(cc2)CNC(=O)c2cccc1c2 |
| InChI | InChI=1S/C32H30N2O4/c35-31-29-5-2-6-30(16-29)32(36)34-18-24-9-13-26(14-10-24)20-38-22-28-4-1-3-27(15-28)21-37-19-25-11-7-23(8-12-25)17-33-31/h1-16H,17-22H2,(H,33,35)(H,34,36) |
| InChIKey | ZOPGQWLLKUHAPG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |