C33H38ClN3O4 — CID 10120863
[2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]-5-ethylphenyl] acetate (PubChem CID 10120863) has the molecular formula C33H38ClN3O4 and a molecular weight of 576.14 g/mol. Its IUPAC name is [2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]-5-ethylphenyl] acetate.
| Compound Name | [2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]-5-ethylphenyl] acetate |
|---|---|
| PubChem CID | 10120863 |
| Molecular Formula | C33H38ClN3O4 |
| Molecular Weight | 576.14 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | [2-[1-[4-[[4-[(4-chlorobenzoyl)amino]benzoyl]amino]butyl]piperidin-4-yl]-5-ethylphenyl] acetate |
| SMILES | CCc1ccc(C2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C33H38ClN3O4/c1-3-24-6-15-30(31(22-24)41-23(2)38)25-16-20-37(21-17-25)19-5-4-18-35-32(39)26-9-13-29(14-10-26)36-33(40)27-7-11-28(34)12-8-27/h6-15,22,25H,3-5,16-21H2,1-2H3,(H,35,39)(H,36,40) |
| InChIKey | BURXNGZCCQJKNK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.14 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|