C32H38ClN3O3 — CID 10280738
4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-ethyl-2-methoxyphenyl)piperidin-1-yl]butyl]benzamide (PubChem CID 10280738) has the molecular formula C32H38ClN3O3 and a molecular weight of 548.13 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-ethyl-2-methoxyphenyl)piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-ethyl-2-methoxyphenyl)piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 10280738 |
| Molecular Formula | C32H38ClN3O3 |
| Molecular Weight | 548.13 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-ethyl-2-methoxyphenyl)piperidin-1-yl]butyl]benzamide |
| SMILES | CCc1ccc(C2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C32H38ClN3O3/c1-3-23-6-15-29(30(22-23)39-2)24-16-20-36(21-17-24)19-5-4-18-34-31(37)25-9-13-28(14-10-25)35-32(38)26-7-11-27(33)12-8-26/h6-15,22,24H,3-5,16-21H2,1-2H3,(H,34,37)(H,35,38) |
| InChIKey | JLKDGUXIDUMOOE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.13 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|