C22H29NO4Si — CID 101208634
[(1R,15S,16Z,17R,19R)-16-(trimethylsilylmethylidene)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-trien-17-yl] acetate (PubChem CID 101208634) has the molecular formula C22H29NO4Si and a molecular weight of 399.56 g/mol. Its IUPAC name is [(1R,15S,16Z,17R,19R)-16-(trimethylsilylmethylidene)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-trien-17-yl] acetate.
| Compound Name | [(1R,15S,16Z,17R,19R)-16-(trimethylsilylmethylidene)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-trien-17-yl] acetate |
|---|---|
| PubChem CID | 101208634 |
| Molecular Formula | C22H29NO4Si |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | [(1R,15S,16Z,17R,19R)-16-(trimethylsilylmethylidene)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-trien-17-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2c3cc4c(cc3CN3CC[C@@H](/C1=C/[Si](C)(C)C)[C@@H]23)OCO4 |
| InChI | InChI=1S/C22H29NO4Si/c1-13(24)27-19-9-17-16-8-21-20(25-12-26-21)7-14(16)10-23-6-5-15(22(17)23)18(19)11-28(2,3)4/h7-8,11,15,17,19,22H,5-6,9-10,12H2,1-4H3/b18-11-/t15-,17+,19+,22-/m0/s1 |
| InChIKey | LZNAEOWNTWTVCY-PZMRRAPMSA-N |
| XLogP | 3.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|