C17H21NO5S — CID 10405694
[(1R,13S,16R,18S)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9-trien-16-yl] methanesulfonate (PubChem CID 10405694) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is [(1R,13S,16R,18S)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9-trien-16-yl] methanesulfonate.
| Compound Name | [(1R,13S,16R,18S)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9-trien-16-yl] methanesulfonate |
|---|---|
| PubChem CID | 10405694 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(1R,13S,16R,18S)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9-trien-16-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1CC[C@H]2[C@@H](C1)[C@H]1CN2Cc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H21NO5S/c1-24(19,20)23-11-2-3-15-13(5-11)14-8-18(15)7-10-4-16-17(6-12(10)14)22-9-21-16/h4,6,11,13-15H,2-3,5,7-9H2,1H3/t11-,13+,14+,15+/m1/s1 |
| InChIKey | UBQPFBWKJOIOGR-UNQGMJICSA-N |
| XLogP | 1.84 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|