C26H31N3O5SSi — CID 15922589
[(2R)-1-[(9S,9aR,10R)-9-(imidazole-1-carbothioyloxy)-5,7,8,9,9a,10-hexahydro-[1,3]benzodioxolo[5,6-f]indolizin-10-yl]-4-trimethylsilylbut-3-yn-2-yl] acetate (PubChem CID 15922589) has the molecular formula C26H31N3O5SSi and a molecular weight of 525.70 g/mol. Its IUPAC name is [(2R)-1-[(9S,9aR,10R)-9-(imidazole-1-carbothioyloxy)-5,7,8,9,9a,10-hexahydro-[1,3]benzodioxolo[5,6-f]indolizin-10-yl]-4-trimethylsilylbut-3-yn-2-yl] acetate.
| Compound Name | [(2R)-1-[(9S,9aR,10R)-9-(imidazole-1-carbothioyloxy)-5,7,8,9,9a,10-hexahydro-[1,3]benzodioxolo[5,6-f]indolizin-10-yl]-4-trimethylsilylbut-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 15922589 |
| Molecular Formula | C26H31N3O5SSi |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | [(2R)-1-[(9S,9aR,10R)-9-(imidazole-1-carbothioyloxy)-5,7,8,9,9a,10-hexahydro-[1,3]benzodioxolo[5,6-f]indolizin-10-yl]-4-trimethylsilylbut-3-yn-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C#C[Si](C)(C)C)C[C@@H]1c2cc3c(cc2CN2CC[C@H](OC(=S)n4ccnc4)[C@@H]12)OCO3 |
| InChI | InChI=1S/C26H31N3O5SSi/c1-17(30)33-19(6-10-36(2,3)4)12-21-20-13-24-23(31-16-32-24)11-18(20)14-28-8-5-22(25(21)28)34-26(35)29-9-7-27-15-29/h7,9,11,13,15,19,21-22,25H,5,8,12,14,16H2,1-4H3/t19-,21+,22-,25+/m0/s1 |
| InChIKey | UXWKWCAHKBFTOP-XIXAVDCQSA-N |
| XLogP | 3.70 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|