C14H22N2O5 — CID 101211289
(E)-3-methoxy-2-methyl-N-[[(1S,2S)-2-(oxan-2-yloxy)cyclopropyl]carbamoyl]prop-2-enamide (PubChem CID 101211289) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (E)-3-methoxy-2-methyl-N-[[(1S,2S)-2-(oxan-2-yloxy)cyclopropyl]carbamoyl]prop-2-enamide.
| Compound Name | (E)-3-methoxy-2-methyl-N-[[(1S,2S)-2-(oxan-2-yloxy)cyclopropyl]carbamoyl]prop-2-enamide |
|---|---|
| PubChem CID | 101211289 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (E)-3-methoxy-2-methyl-N-[[(1S,2S)-2-(oxan-2-yloxy)cyclopropyl]carbamoyl]prop-2-enamide |
| SMILES | CO/C=C(\C)C(=O)NC(=O)N[C@H]1C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C14H22N2O5/c1-9(8-19-2)13(17)16-14(18)15-10-7-11(10)21-12-5-3-4-6-20-12/h8,10-12H,3-7H2,1-2H3,(H2,15,16,17,18)/b9-8+/t10-,11-,12?/m0/s1 |
| InChIKey | YSZAXNCRGBAHNC-VAQBMPQGSA-N |
| XLogP | 1.05 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|