C17H19NO4S — CID 101211774
ethyl (2Z)-5-methyl-2-(2-oxo-2-phenylmethoxyethylidene)-3,6-dihydro-1,3-thiazine-4-carboxylate (PubChem CID 101211774) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl (2Z)-5-methyl-2-(2-oxo-2-phenylmethoxyethylidene)-3,6-dihydro-1,3-thiazine-4-carboxylate.
| Compound Name | ethyl (2Z)-5-methyl-2-(2-oxo-2-phenylmethoxyethylidene)-3,6-dihydro-1,3-thiazine-4-carboxylate |
|---|---|
| PubChem CID | 101211774 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl (2Z)-5-methyl-2-(2-oxo-2-phenylmethoxyethylidene)-3,6-dihydro-1,3-thiazine-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)CS/C(=C\C(=O)OCc2ccccc2)N1 |
| InChI | InChI=1S/C17H19NO4S/c1-3-21-17(20)16-12(2)11-23-14(18-16)9-15(19)22-10-13-7-5-4-6-8-13/h4-9,18H,3,10-11H2,1-2H3/b14-9- |
| InChIKey | HHGRCQXTAKDFDS-ZROIWOOFSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|