About ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate
ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate (PubChem CID 101467249) has the molecular formula C22H21NO5
and a molecular weight of 379.41 g/mol. Its IUPAC name is ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate |
| PubChem CID | 101467249 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\NC(=O)C(OCc2ccccc2)=C1OCc1ccccc1 |
| InChI | InChI=1S/C22H21NO5/c1-2-26-19(24)13-18-20(27-14-16-9-5-3-6-10-16)21(22(25)23-18)28-15-17-11-7-4-8-12-17/h3-13H,2,14-15H2,1H3,(H,23,25)/b18-13- |
| InChIKey | RXDMDWHMBFECMO-AQTBWJFISA-N |
| XLogP | 3.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate?
The IUPAC name of ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate (CID 101467249) is ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate is CCOC(=O)/C=C1\NC(=O)C(OCc2ccccc2)=C1OCc1ccccc1.
What is the InChIKey of ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate?
The InChIKey is RXDMDWHMBFECMO-AQTBWJFISA-N. The full InChI is InChI=1S/C22H21NO5/c1-2-26-19(24)13-18-20(27-14-16-9-5-3-6-10-16)21(22(25)23-18)28-15-17-11-7-4-8-12-17/h3-13H,2,14-15H2,1H3,(H,23,25)/b18-13-.
What are the key properties of ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate?
ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate has a molecular weight of 379.41 g/mol, XLogP of 3.21, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-[5-oxo-3,4-bis(phenylmethoxy)pyrrol-2-ylidene]acetate is sourced from PubChem (CID 101467249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).