About 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one
2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one (PubChem CID 163610086) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one |
| PubChem CID | 163610086 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one |
| SMILES | CC1=C(OCc2ccccc2)C(=O)NC(C)(N)N1 |
| InChI | InChI=1S/C13H17N3O2/c1-9-11(12(17)16-13(2,14)15-9)18-8-10-6-4-3-5-7-10/h3-7,15H,8,14H2,1-2H3,(H,16,17) |
| InChIKey | YPNIDVLOWIZHNH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one?
The IUPAC name of 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one (CID 163610086) is 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one.
What is the SMILES notation for 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one?
The canonical SMILES for 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one is CC1=C(OCc2ccccc2)C(=O)NC(C)(N)N1.
What is the InChIKey of 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one?
The InChIKey is YPNIDVLOWIZHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-9-11(12(17)16-13(2,14)15-9)18-8-10-6-4-3-5-7-10/h3-7,15H,8,14H2,1-2H3,(H,16,17).
What are the key properties of 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one?
2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one has a molecular weight of 247.30 g/mol, XLogP of 0.79, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2,6-dimethyl-5-phenylmethoxy-1,3-dihydropyrimidin-4-one is sourced from PubChem (CID 163610086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).