C12H13NO3 — CID 57435374
4,4-dimethyl-2-phenylmethoxy-1,3-oxazol-5-one (PubChem CID 57435374) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4,4-dimethyl-2-phenylmethoxy-1,3-oxazol-5-one.
| Compound Name | 4,4-dimethyl-2-phenylmethoxy-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 57435374 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4,4-dimethyl-2-phenylmethoxy-1,3-oxazol-5-one |
| SMILES | CC1(C)N=C(OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C12H13NO3/c1-12(2)10(14)16-11(13-12)15-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | WVRMZNQRQJLYHU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |