C30H29NO8 — CID 11562805
[(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] 4-hydroxy-3,5-bis(phenylmethoxy)benzoate (PubChem CID 11562805) has the molecular formula C30H29NO8 and a molecular weight of 531.56 g/mol. Its IUPAC name is [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] 4-hydroxy-3,5-bis(phenylmethoxy)benzoate.
| Compound Name | [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] 4-hydroxy-3,5-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 11562805 |
| Molecular Formula | C30H29NO8 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] 4-hydroxy-3,5-bis(phenylmethoxy)benzoate |
| SMILES | CCOC(=O)/C=C1\NC(=O)[C@@H]1[C@@H](C)OC(=O)c1cc(OCc2ccccc2)c(O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H29NO8/c1-3-36-26(32)16-23-27(29(34)31-23)19(2)39-30(35)22-14-24(37-17-20-10-6-4-7-11-20)28(33)25(15-22)38-18-21-12-8-5-9-13-21/h4-16,19,27,33H,3,17-18H2,1-2H3,(H,31,34)/b23-16-/t19-,27-/m1/s1 |
| InChIKey | WJMUWEBGODGZSG-OXHAUKAOSA-N |
| XLogP | 4.29 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|