C24H25NO8 — CID 11691033
[(1R)-1-[(3S,4Z)-2-oxo-4-(2-oxo-2-phenylmethoxyethylidene)azetidin-3-yl]ethyl] 3,4,5-trimethoxybenzoate (PubChem CID 11691033) has the molecular formula C24H25NO8 and a molecular weight of 455.46 g/mol. Its IUPAC name is [(1R)-1-[(3S,4Z)-2-oxo-4-(2-oxo-2-phenylmethoxyethylidene)azetidin-3-yl]ethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(1R)-1-[(3S,4Z)-2-oxo-4-(2-oxo-2-phenylmethoxyethylidene)azetidin-3-yl]ethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 11691033 |
| Molecular Formula | C24H25NO8 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [(1R)-1-[(3S,4Z)-2-oxo-4-(2-oxo-2-phenylmethoxyethylidene)azetidin-3-yl]ethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@H](C)[C@H]2C(=O)N/C2=C\C(=O)OCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H25NO8/c1-14(33-24(28)16-10-18(29-2)22(31-4)19(11-16)30-3)21-17(25-23(21)27)12-20(26)32-13-15-8-6-5-7-9-15/h5-12,14,21H,13H2,1-4H3,(H,25,27)/b17-12-/t14-,21-/m1/s1 |
| InChIKey | LXKPHFXRDWTHNO-AAAVNFPLSA-N |
| XLogP | 2.63 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|