C19H23NO6 — CID 67887926
diethyl (3E)-3-(2-oxo-2-phenylmethoxyethylidene)pyrrolidine-1,2-dicarboxylate (PubChem CID 67887926) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is diethyl (3E)-3-(2-oxo-2-phenylmethoxyethylidene)pyrrolidine-1,2-dicarboxylate.
| Compound Name | diethyl (3E)-3-(2-oxo-2-phenylmethoxyethylidene)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67887926 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | diethyl (3E)-3-(2-oxo-2-phenylmethoxyethylidene)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1/C(=C/C(=O)OCc2ccccc2)CCN1C(=O)OCC |
| InChI | InChI=1S/C19H23NO6/c1-3-24-18(22)17-15(10-11-20(17)19(23)25-4-2)12-16(21)26-13-14-8-6-5-7-9-14/h5-9,12,17H,3-4,10-11,13H2,1-2H3/b15-12+ |
| InChIKey | ZLOLBPIYQAJZBJ-NTCAYCPXSA-N |
| XLogP | 2.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|