C18H24O3 — CID 101212041
2-butyl-5-(methoxymethoxy)-2-prop-2-enyl-3H-inden-1-one (PubChem CID 101212041) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-butyl-5-(methoxymethoxy)-2-prop-2-enyl-3H-inden-1-one.
| Compound Name | 2-butyl-5-(methoxymethoxy)-2-prop-2-enyl-3H-inden-1-one |
|---|---|
| PubChem CID | 101212041 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-butyl-5-(methoxymethoxy)-2-prop-2-enyl-3H-inden-1-one |
| SMILES | C=CCC1(CCCC)Cc2cc(OCOC)ccc2C1=O |
| InChI | InChI=1S/C18H24O3/c1-4-6-10-18(9-5-2)12-14-11-15(21-13-20-3)7-8-16(14)17(18)19/h5,7-8,11H,2,4,6,9-10,12-13H2,1,3H3 |
| InChIKey | DXIXKEHTBGOOJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|