C12H21NO2 — CID 101212518
2-[(2R,3R)-2,3-dimethyl-3-propyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 101212518) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[(2R,3R)-2,3-dimethyl-3-propyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2R,3R)-2,3-dimethyl-3-propyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 101212518 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[(2R,3R)-2,3-dimethyl-3-propyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCC[C@@]1(C)O[C@@]1(C)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C12H21NO2/c1-6-7-11(4)12(5,15-11)9-13-10(2,3)8-14-9/h6-8H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | GJGDUMGOYOAJJP-NEPJUHHUSA-N |
| XLogP | 2.54 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|