C7H9NO — CID 101212572
(1R,4S)-1-ethyl-2-azabicyclo[2.2.0]hex-5-en-3-one (PubChem CID 101212572) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is (1R,4S)-1-ethyl-2-azabicyclo[2.2.0]hex-5-en-3-one.
| Compound Name | (1R,4S)-1-ethyl-2-azabicyclo[2.2.0]hex-5-en-3-one |
|---|---|
| PubChem CID | 101212572 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (1R,4S)-1-ethyl-2-azabicyclo[2.2.0]hex-5-en-3-one |
| SMILES | CC[C@@]12C=C[C@@H]1C(=O)N2 |
| InChI | InChI=1S/C7H9NO/c1-2-7-4-3-5(7)6(9)8-7/h3-5H,2H2,1H3,(H,8,9)/t5-,7-/m1/s1 |
| InChIKey | RRNRUPDQWMWJQX-IYSWYEEDSA-N |
| XLogP | 0.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|