C20H19NO4 — CID 101212718
3-(2-cyclohexyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 101212718) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-(2-cyclohexyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-(2-cyclohexyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 101212718 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-(2-cyclohexyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(O)C(=O)C(c2c(C3CCCCC3)[nH]c3ccccc23)=C1O |
| InChI | InChI=1S/C20H19NO4/c22-14-10-15(23)20(25)17(19(14)24)16-12-8-4-5-9-13(12)21-18(16)11-6-2-1-3-7-11/h4-5,8-11,21-22,25H,1-3,6-7H2 |
| InChIKey | FVDWKNGPNOLEKS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|