C25H28O3 — CID 101213115
6,6-bis(phenylmethoxymethyl)non-8-en-3-yn-2-one (PubChem CID 101213115) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 6,6-bis(phenylmethoxymethyl)non-8-en-3-yn-2-one.
| Compound Name | 6,6-bis(phenylmethoxymethyl)non-8-en-3-yn-2-one |
|---|---|
| PubChem CID | 101213115 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6,6-bis(phenylmethoxymethyl)non-8-en-3-yn-2-one |
| SMILES | C=CCC(CC#CC(C)=O)(COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C25H28O3/c1-3-16-25(17-10-11-22(2)26,20-27-18-23-12-6-4-7-13-23)21-28-19-24-14-8-5-9-15-24/h3-9,12-15H,1,16-21H2,2H3 |
| InChIKey | GKRRDBZQAPGJAF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|