C27H34O2 — CID 101218026
[(5E,7E)-2-(phenylmethoxymethyl)-2-prop-2-enylnona-5,7-dienoxy]methylbenzene (PubChem CID 101218026) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is [(5E,7E)-2-(phenylmethoxymethyl)-2-prop-2-enylnona-5,7-dienoxy]methylbenzene.
| Compound Name | [(5E,7E)-2-(phenylmethoxymethyl)-2-prop-2-enylnona-5,7-dienoxy]methylbenzene |
|---|---|
| PubChem CID | 101218026 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(5E,7E)-2-(phenylmethoxymethyl)-2-prop-2-enylnona-5,7-dienoxy]methylbenzene |
| SMILES | C=CCC(CC/C=C/C=C/C)(COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C27H34O2/c1-3-5-6-7-14-20-27(19-4-2,23-28-21-25-15-10-8-11-16-25)24-29-22-26-17-12-9-13-18-26/h3-13,15-18H,2,14,19-24H2,1H3/b5-3+,7-6+ |
| InChIKey | LRUFDCLQSIRURD-TWTPFVCWSA-N |
| XLogP | 6.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|