C11H20O2 — CID 101214956
2-(1-hydroxy-2-methylpropyl)-5-methylcyclohexan-1-one (PubChem CID 101214956) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(1-hydroxy-2-methylpropyl)-5-methylcyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-methylpropyl)-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 101214956 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-(1-hydroxy-2-methylpropyl)-5-methylcyclohexan-1-one |
| SMILES | CC1CCC(C(O)C(C)C)C(=O)C1 |
| InChI | InChI=1S/C11H20O2/c1-7(2)11(13)9-5-4-8(3)6-10(9)12/h7-9,11,13H,4-6H2,1-3H3 |
| InChIKey | BXWQGRMWTLWYTB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |