C16H30OS2 — CID 101215122
(3R)-3-(1,3-dithian-2-yl)dodec-1-en-4-ol (PubChem CID 101215122) has the molecular formula C16H30OS2 and a molecular weight of 302.55 g/mol. Its IUPAC name is (3R)-3-(1,3-dithian-2-yl)dodec-1-en-4-ol.
| Compound Name | (3R)-3-(1,3-dithian-2-yl)dodec-1-en-4-ol |
|---|---|
| PubChem CID | 101215122 |
| Molecular Formula | C16H30OS2 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (3R)-3-(1,3-dithian-2-yl)dodec-1-en-4-ol |
| SMILES | C=C[C@H](C(O)CCCCCCCC)C1SCCCS1 |
| InChI | InChI=1S/C16H30OS2/c1-3-5-6-7-8-9-11-15(17)14(4-2)16-18-12-10-13-19-16/h4,14-17H,2-3,5-13H2,1H3/t14-,15?/m1/s1 |
| InChIKey | JFAAXLWIROLSJU-GICMACPYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|