C13H26O3 — CID 88872101
(3S,5R,6R)-tridec-1-ene-3,5,6-triol (PubChem CID 88872101) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (3S,5R,6R)-tridec-1-ene-3,5,6-triol.
| Compound Name | (3S,5R,6R)-tridec-1-ene-3,5,6-triol |
|---|---|
| PubChem CID | 88872101 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (3S,5R,6R)-tridec-1-ene-3,5,6-triol |
| SMILES | C=C[C@@H](O)C[C@@H](O)[C@H](O)CCCCCCC |
| InChI | InChI=1S/C13H26O3/c1-3-5-6-7-8-9-12(15)13(16)10-11(14)4-2/h4,11-16H,2-3,5-10H2,1H3/t11-,12-,13-/m1/s1 |
| InChIKey | BRAQUERYGOLEJQ-JHJVBQTASA-N |
| XLogP | 2.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|