C14H16N2+2 — CID 101215330
5,10-diazoniatricyclo[8.2.2.22,5]hexadeca-1(13),2(16),3,5(15),10(14),11-hexaene (PubChem CID 101215330) has the molecular formula C14H16N2+2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 5,10-diazoniatricyclo[8.2.2.22,5]hexadeca-1(13),2(16),3,5(15),10(14),11-hexaene.
| Compound Name | 5,10-diazoniatricyclo[8.2.2.22,5]hexadeca-1(13),2(16),3,5(15),10(14),11-hexaene |
|---|---|
| PubChem CID | 101215330 |
| Molecular Formula | C14H16N2+2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5,10-diazoniatricyclo[8.2.2.22,5]hexadeca-1(13),2(16),3,5(15),10(14),11-hexaene |
| SMILES | c1c[n+]2ccc1-c1cc[n+](cc1)CCCC2 |
| InChI | InChI=1S/C14H16N2/c1-2-8-16-11-5-14(6-12-16)13-3-9-15(7-1)10-4-13/h3-6,9-12H,1-2,7-8H2/q+2 |
| InChIKey | JJCXXFKOCOXHMD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|