C60H48N12+6 — CID 140820000
CID 140820000 (PubChem CID 140820000) has the molecular formula C60H48N12+6 and a molecular weight of 937.13 g/mol.
| Compound Name | CID 140820000 |
|---|---|
| PubChem CID | 140820000 |
| Molecular Formula | C60H48N12+6 |
| Molecular Weight | 937.13 g/mol |
| Exact Mass | 936.41 |
| IUPAC Name | — |
| SMILES | c1cc2ccc1C[n+]1ccc(cc1)-c1nc3nc(n1)-c1cc[n+](cc1)Cc1ccc(cc1)C[n+]1ccc(cc1)-c1nc(nc(n1)-c1cc[n+](cc1)Cc1ccc(cc1)C[n+]1ccc-3cc1)-c1cc[n+](cc1)C2 |
| InChI | InChI=1S/C60H48N12/c1-2-44-4-3-43(1)37-67-25-13-49(14-26-67)55-61-57-51-17-29-69(30-18-51)39-45-5-9-47(10-6-45)41-71-33-21-53(22-34-71)59-63-56(50-15-27-68(38-44)28-16-50)64-60(66-59)54-23-35-72(36-24-54)42-48-11-7-46(8-12-48)40-70-31-19-52(20-32-70)58(62-55)65-57/h1-36H,37-42H2/q+6 |
| InChIKey | JIGLSZYHAAPRCS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 100.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.13 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|