C21H21N9 — CID 58752520
[4-[4,6-bis(4-hydrazinylphenyl)-1,3,5-triazin-2-yl]phenyl]hydrazine (PubChem CID 58752520) has the molecular formula C21H21N9 and a molecular weight of 399.46 g/mol. Its IUPAC name is [4-[4,6-bis(4-hydrazinylphenyl)-1,3,5-triazin-2-yl]phenyl]hydrazine.
| Compound Name | [4-[4,6-bis(4-hydrazinylphenyl)-1,3,5-triazin-2-yl]phenyl]hydrazine |
|---|---|
| PubChem CID | 58752520 |
| Molecular Formula | C21H21N9 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | [4-[4,6-bis(4-hydrazinylphenyl)-1,3,5-triazin-2-yl]phenyl]hydrazine |
| SMILES | NNc1ccc(-c2nc(-c3ccc(NN)cc3)nc(-c3ccc(NN)cc3)n2)cc1 |
| InChI | InChI=1S/C21H21N9/c22-28-16-7-1-13(2-8-16)19-25-20(14-3-9-17(29-23)10-4-14)27-21(26-19)15-5-11-18(30-24)12-6-15/h1-12,28-30H,22-24H2 |
| InChIKey | VTYDXDUWCVOYTH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|