C19H35NO5 — CID 101215487
tert-butyl (4S,5R)-2,2,4-trimethyl-5-[[(4S,5R)-2,2,4-trimethyl-1,3-dioxan-5-yl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 101215487) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is tert-butyl (4S,5R)-2,2,4-trimethyl-5-[[(4S,5R)-2,2,4-trimethyl-1,3-dioxan-5-yl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-2,2,4-trimethyl-5-[[(4S,5R)-2,2,4-trimethyl-1,3-dioxan-5-yl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101215487 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | tert-butyl (4S,5R)-2,2,4-trimethyl-5-[[(4S,5R)-2,2,4-trimethyl-1,3-dioxan-5-yl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1OC(C)(C)OC[C@H]1C[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C19H35NO5/c1-12-15(10-14-11-22-19(8,9)23-13(14)2)24-18(6,7)20(12)16(21)25-17(3,4)5/h12-15H,10-11H2,1-9H3/t12-,13-,14+,15+/m0/s1 |
| InChIKey | OWDBKNABIKGADD-BYNSBNAKSA-N |
| XLogP | 3.92 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |