C17H28O4 — CID 101215595
[(2R)-2,3-dihydroxypropyl] (2E,4E)-tetradeca-2,4,13-trienoate (PubChem CID 101215595) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] (2E,4E)-tetradeca-2,4,13-trienoate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] (2E,4E)-tetradeca-2,4,13-trienoate |
|---|---|
| PubChem CID | 101215595 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] (2E,4E)-tetradeca-2,4,13-trienoate |
| SMILES | C=CCCCCCCC/C=C/C=C/C(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C17H28O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)21-15-16(19)14-18/h2,10-13,16,18-19H,1,3-9,14-15H2/b11-10+,13-12+/t16-/m1/s1 |
| InChIKey | BPQZRDKXYMYZRL-COUJEVKVSA-N |
| XLogP | 2.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|