C42H37NO9Se — CID 101216186
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[4-(dimethylamino)phenyl]selanyloxan-2-yl]methyl benzoate (PubChem CID 101216186) has the molecular formula C42H37NO9Se and a molecular weight of 778.72 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[4-(dimethylamino)phenyl]selanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[4-(dimethylamino)phenyl]selanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101216186 |
| Molecular Formula | C42H37NO9Se |
| Molecular Weight | 778.72 g/mol |
| Exact Mass | 779.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[4-(dimethylamino)phenyl]selanyloxan-2-yl]methyl benzoate |
| SMILES | CN(C)c1ccc([Se][C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H37NO9Se/c1-43(2)32-23-25-33(26-24-32)53-42-37(52-41(47)31-21-13-6-14-22-31)36(51-40(46)30-19-11-5-12-20-30)35(50-39(45)29-17-9-4-10-18-29)34(49-42)27-48-38(44)28-15-7-3-8-16-28/h3-26,34-37,42H,27H2,1-2H3/t34-,35-,36+,37-,42+/m1/s1 |
| InChIKey | LXMJHJVHRNYGJL-IQEGRXIQSA-N |
| XLogP | 5.34 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.72 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|