C25H29NO6 — CID 101216373
benzyl N-[(3S,5S,6R)-5-acetyl-6-hydroxy-1,8-dioxo-1-phenylnonan-3-yl]carbamate (PubChem CID 101216373) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is benzyl N-[(3S,5S,6R)-5-acetyl-6-hydroxy-1,8-dioxo-1-phenylnonan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S,5S,6R)-5-acetyl-6-hydroxy-1,8-dioxo-1-phenylnonan-3-yl]carbamate |
|---|---|
| PubChem CID | 101216373 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | benzyl N-[(3S,5S,6R)-5-acetyl-6-hydroxy-1,8-dioxo-1-phenylnonan-3-yl]carbamate |
| SMILES | CC(=O)C[C@@H](O)[C@H](C[C@@H](CC(=O)c1ccccc1)NC(=O)OCc1ccccc1)C(C)=O |
| InChI | InChI=1S/C25H29NO6/c1-17(27)13-24(30)22(18(2)28)14-21(15-23(29)20-11-7-4-8-12-20)26-25(31)32-16-19-9-5-3-6-10-19/h3-12,21-22,24,30H,13-16H2,1-2H3,(H,26,31)/t21-,22+,24+/m0/s1 |
| InChIKey | VDCMDCONUBHYEL-WMTXJRDZSA-N |
| XLogP | 3.49 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |