C18H20O4 — CID 101216932
ethyl (1R,4R,6R)-1-methyl-3-oxo-6-(1-phenylethenyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylate (PubChem CID 101216932) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is ethyl (1R,4R,6R)-1-methyl-3-oxo-6-(1-phenylethenyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylate.
| Compound Name | ethyl (1R,4R,6R)-1-methyl-3-oxo-6-(1-phenylethenyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
|---|---|
| PubChem CID | 101216932 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl (1R,4R,6R)-1-methyl-3-oxo-6-(1-phenylethenyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
| SMILES | C=C(c1ccccc1)[C@H]1C[C@]2(C(=O)OCC)C[C@@]1(C)OC2=O |
| InChI | InChI=1S/C18H20O4/c1-4-21-15(19)18-10-14(17(3,11-18)22-16(18)20)12(2)13-8-6-5-7-9-13/h5-9,14H,2,4,10-11H2,1,3H3/t14-,17-,18-/m1/s1 |
| InChIKey | NWEOJNAXYLDLRB-ZTFGCOKTSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|