C21H25FO4 — CID 57276728
methyl 7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-formyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 57276728) has the molecular formula C21H25FO4 and a molecular weight of 360.43 g/mol. Its IUPAC name is methyl 7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-formyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl 7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-formyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 57276728 |
| Molecular Formula | C21H25FO4 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | methyl 7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-formyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1[C@H](C=O)[C@@H]2C[C@@]1(c1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C21H25FO4/c1-25-20(24)7-5-3-2-4-6-18-17(13-23)19-12-21(18,14-26-19)15-8-10-16(22)11-9-15/h2,4,8-11,13,17-19H,3,5-7,12,14H2,1H3/t17-,18-,19-,21-/m0/s1 |
| InChIKey | HORMLAQIRNAIDU-IWFBPKFRSA-N |
| XLogP | 3.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|