C18H24O6 — CID 101218247
dimethyl 3-oxo-1,4-di(propan-2-yl)-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 101218247) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is dimethyl 3-oxo-1,4-di(propan-2-yl)-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dimethyl 3-oxo-1,4-di(propan-2-yl)-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 101218247 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | dimethyl 3-oxo-1,4-di(propan-2-yl)-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(C(C)C)oc(=O)c(C(C)C)c2C1 |
| InChI | InChI=1S/C18H24O6/c1-9(2)13-11-7-18(16(20)22-5,17(21)23-6)8-12(11)14(10(3)4)24-15(13)19/h9-10H,7-8H2,1-6H3 |
| InChIKey | CCHXBTSVWXLQTR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|