C16H22O6Si — CID 11439163
dimethyl 4-methyl-3-oxo-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 11439163) has the molecular formula C16H22O6Si and a molecular weight of 338.43 g/mol. Its IUPAC name is dimethyl 4-methyl-3-oxo-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dimethyl 4-methyl-3-oxo-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 11439163 |
| Molecular Formula | C16H22O6Si |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | dimethyl 4-methyl-3-oxo-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c([Si](C)(C)C)oc(=O)c(C)c2C1 |
| InChI | InChI=1S/C16H22O6Si/c1-9-10-7-16(14(18)20-2,15(19)21-3)8-11(10)13(22-12(9)17)23(4,5)6/h7-8H2,1-6H3 |
| InChIKey | PYUWQCCGSGQCHT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|