C17H22O6 — CID 177498956
dimethyl 4-tert-butyl-1-methyl-3-oxo-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 177498956) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is dimethyl 4-tert-butyl-1-methyl-3-oxo-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dimethyl 4-tert-butyl-1-methyl-3-oxo-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 177498956 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | dimethyl 4-tert-butyl-1-methyl-3-oxo-5,7-dihydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(C)oc(=O)c(C(C)(C)C)c2C1 |
| InChI | InChI=1S/C17H22O6/c1-9-10-7-17(14(19)21-5,15(20)22-6)8-11(10)12(13(18)23-9)16(2,3)4/h7-8H2,1-6H3 |
| InChIKey | CHVXYGCBPYNWOK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|