C29H31F2N2O+ — CID 101219958
4-[(R)-[(1S,2S,4S,5R)-1-[(2,3-difluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline (PubChem CID 101219958) has the molecular formula C29H31F2N2O+ and a molecular weight of 461.58 g/mol. Its IUPAC name is 4-[(R)-[(1S,2S,4S,5R)-1-[(2,3-difluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(1S,2S,4S,5R)-1-[(2,3-difluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
|---|---|
| PubChem CID | 101219958 |
| Molecular Formula | C29H31F2N2O+ |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 4-[(R)-[(1S,2S,4S,5R)-1-[(2,3-difluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
| SMILES | C=CCO[C@H](c1ccnc2ccccc12)[C@@H]1C[C@@H]2CC[N@@+]1(Cc1cccc(F)c1F)C[C@@H]2C=C |
| InChI | InChI=1S/C29H31F2N2O/c1-3-16-34-29(24-12-14-32-26-11-6-5-9-23(24)26)27-17-21-13-15-33(27,18-20(21)4-2)19-22-8-7-10-25(30)28(22)31/h3-12,14,20-21,27,29H,1-2,13,15-19H2/q+1/t20-,21-,27-,29+,33-/m0/s1 |
| InChIKey | LHIAMOAUUQGVLM-JZLICQMGSA-N |
| XLogP | 6.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|