C35H33F4N2O+ — CID 177479793
4-[(R)-[(1S,2S,4S,5S)-5-[(E)-2-(4-fluorophenyl)ethenyl]-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline (PubChem CID 177479793) has the molecular formula C35H33F4N2O+ and a molecular weight of 573.65 g/mol. Its IUPAC name is 4-[(R)-[(1S,2S,4S,5S)-5-[(E)-2-(4-fluorophenyl)ethenyl]-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(1S,2S,4S,5S)-5-[(E)-2-(4-fluorophenyl)ethenyl]-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
|---|---|
| PubChem CID | 177479793 |
| Molecular Formula | C35H33F4N2O+ |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 4-[(R)-[(1S,2S,4S,5S)-5-[(E)-2-(4-fluorophenyl)ethenyl]-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
| SMILES | C=CCO[C@H](c1ccnc2ccccc12)[C@@H]1C[C@@H]2CC[N@@+]1(Cc1ccc(F)c(F)c1F)C[C@@H]2/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C35H33F4N2O/c1-2-19-42-35(29-15-17-40-31-6-4-3-5-28(29)31)32-20-24-16-18-41(32,22-26-11-14-30(37)34(39)33(26)38)21-25(24)10-7-23-8-12-27(36)13-9-23/h2-15,17,24-25,32,35H,1,16,18-22H2/q+1/b10-7+/t24-,25-,32-,35+,41-/m0/s1 |
| InChIKey | NOOFBSDESZMXAJ-RFUAGDFJSA-N |
| XLogP | 8.17 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|